C15H16ClF3N2O — CID 108912646
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclohexylidenemethyl)urea (PubChem CID 108912646) has the molecular formula C15H16ClF3N2O and a molecular weight of 332.75 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclohexylidenemethyl)urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclohexylidenemethyl)urea |
|---|---|
| PubChem CID | 108912646 |
| Molecular Formula | C15H16ClF3N2O |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclohexylidenemethyl)urea |
| SMILES | O=C(NC=C1CCCCC1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16ClF3N2O/c16-11-6-7-13(12(8-11)15(17,18)19)21-14(22)20-9-10-4-2-1-3-5-10/h6-9H,1-5H2,(H2,20,21,22) |
| InChIKey | PJIGKCHKPPJIPH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |