C14H16Cl2N2O — CID 108912397
1-(cyclohexylidenemethyl)-3-(2,4-dichlorophenyl)urea (PubChem CID 108912397) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 1-(cyclohexylidenemethyl)-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-(cyclohexylidenemethyl)-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108912397 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(cyclohexylidenemethyl)-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(NC=C1CCCCC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O/c15-11-6-7-13(12(16)8-11)18-14(19)17-9-10-4-2-1-3-5-10/h6-9H,1-5H2,(H2,17,18,19) |
| InChIKey | HWGJOYMGZLRTEV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |