C7H5Cl4N2O2P — CID 91621924
1-(2,4-dichlorophenyl)-3-dichlorophosphorylurea (PubChem CID 91621924) has the molecular formula C7H5Cl4N2O2P and a molecular weight of 321.92 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-dichlorophosphorylurea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-dichlorophosphorylurea |
|---|---|
| PubChem CID | 91621924 |
| Molecular Formula | C7H5Cl4N2O2P |
| Molecular Weight | 321.92 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-dichlorophosphorylurea |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)NP(=O)(Cl)Cl |
| InChI | InChI=1S/C7H5Cl4N2O2P/c8-4-1-2-6(5(9)3-4)12-7(14)13-16(10,11)15/h1-3H,(H2,12,13,14,15) |
| InChIKey | OYNYOOGWPDEMAG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|