C18H10Cl4N2O2S — CID 2329395
2-N,5-N-bis(2,4-dichlorophenyl)thiophene-2,5-dicarboxamide (PubChem CID 2329395) has the molecular formula C18H10Cl4N2O2S and a molecular weight of 460.17 g/mol. Its IUPAC name is 2-N,5-N-bis(2,4-dichlorophenyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(2,4-dichlorophenyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 2329395 |
| Molecular Formula | C18H10Cl4N2O2S |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | 2-N,5-N-bis(2,4-dichlorophenyl)thiophene-2,5-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccc(C(=O)Nc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C18H10Cl4N2O2S/c19-9-1-3-13(11(21)7-9)23-17(25)15-5-6-16(27-15)18(26)24-14-4-2-10(20)8-12(14)22/h1-8H,(H,23,25)(H,24,26) |
| InChIKey | LCCWRTPGVZHRPU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |