C26H16Cl4N2O2 — CID 5150334
N-(2,4-dichlorophenyl)-2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]benzamide (PubChem CID 5150334) has the molecular formula C26H16Cl4N2O2 and a molecular weight of 530.24 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]benzamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5150334 |
| Molecular Formula | C26H16Cl4N2O2 |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccccc1-c1ccccc1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H16Cl4N2O2/c27-15-9-11-23(21(29)13-15)31-25(33)19-7-3-1-5-17(19)18-6-2-4-8-20(18)26(34)32-24-12-10-16(28)14-22(24)30/h1-14H,(H,31,33)(H,32,34) |
| InChIKey | DRRUYRMQOLOKAB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |