C26H16Cl4N2O2S2 — CID 6483556
N-(2,4-dichlorophenyl)-2-[[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]disulfanyl]benzamide (PubChem CID 6483556) has the molecular formula C26H16Cl4N2O2S2 and a molecular weight of 594.37 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]disulfanyl]benzamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]disulfanyl]benzamide |
|---|---|
| PubChem CID | 6483556 |
| Molecular Formula | C26H16Cl4N2O2S2 |
| Molecular Weight | 594.37 g/mol |
| Exact Mass | 591.94 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]disulfanyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccccc1SSc1ccccc1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H16Cl4N2O2S2/c27-15-9-11-21(19(29)13-15)31-25(33)17-5-1-3-7-23(17)35-36-24-8-4-2-6-18(24)26(34)32-22-12-10-16(28)14-20(22)30/h1-14H,(H,31,33)(H,32,34) |
| InChIKey | KSOXWUWHJAZNDP-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.37 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|