C18H18Cl2N2O3S — CID 55335321
N-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 55335321) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 55335321 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-25-9-8-21-17(23)11-26-16-5-3-2-4-13(16)18(24)22-15-7-6-12(19)10-14(15)20/h2-7,10H,8-9,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | BSZRMLSNKYUPHP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|