C23H29N3O4S — CID 38254442
N-[4-(tert-butylcarbamoyl)phenyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 38254442) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[4-(tert-butylcarbamoyl)phenyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-[4-(tert-butylcarbamoyl)phenyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 38254442 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[4-(tert-butylcarbamoyl)phenyl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)Nc1ccc(C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-23(2,3)26-21(28)16-9-11-17(12-10-16)25-22(29)18-7-5-6-8-19(18)31-15-20(27)24-13-14-30-4/h5-12H,13-15H2,1-4H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | KFBCHXXRPMSHRJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|