C17H25NO5S — CID 55356954
2-propan-2-yloxyethyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 55356954) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 2-propan-2-yloxyethyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 55356954 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)OCCOC(C)C |
| InChI | InChI=1S/C17H25NO5S/c1-13(2)22-10-11-23-17(20)14-6-4-5-7-15(14)24-12-16(19)18-8-9-21-3/h4-7,13H,8-12H2,1-3H3,(H,18,19) |
| InChIKey | UNMUGKQXHPNHHC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|