C12H9Cl2NOS — CID 17432904
5-chloro-N-(4-chloro-2-methylphenyl)thiophene-2-carboxamide (PubChem CID 17432904) has the molecular formula C12H9Cl2NOS and a molecular weight of 286.18 g/mol. Its IUPAC name is 5-chloro-N-(4-chloro-2-methylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(4-chloro-2-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17432904 |
| Molecular Formula | C12H9Cl2NOS |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 5-chloro-N-(4-chloro-2-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H9Cl2NOS/c1-7-6-8(13)2-3-9(7)15-12(16)10-4-5-11(14)17-10/h2-6H,1H3,(H,15,16) |
| InChIKey | KXVHVIOYRKJAJF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |