C7H6Cl2N2O2 — CID 4295489
1-(2,4-dichlorophenyl)-3-hydroxyurea (PubChem CID 4295489) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-hydroxyurea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-hydroxyurea |
|---|---|
| PubChem CID | 4295489 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-hydroxyurea |
| SMILES | O=C(NO)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl2N2O2/c8-4-1-2-6(5(9)3-4)10-7(12)11-13/h1-3,13H,(H2,10,11,12) |
| InChIKey | DJPGEWSKXZZHCC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|