C14H10Cl4N2O — CID 54811499
2-(2,4-dichloroanilino)-N-(2,4-dichlorophenyl)acetamide (PubChem CID 54811499) has the molecular formula C14H10Cl4N2O and a molecular weight of 364.06 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(2,4-dichloroanilino)-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 54811499 |
| Molecular Formula | C14H10Cl4N2O |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 2-(2,4-dichloroanilino)-N-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1Cl)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl4N2O/c15-8-1-3-12(10(17)5-8)19-7-14(21)20-13-4-2-9(16)6-11(13)18/h1-6,19H,7H2,(H,20,21) |
| InChIKey | SKHGNSASBUDKES-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |