C16H16Cl2N2O2 — CID 26417516
2-(2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 26417516) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 26417516 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(2,4-dichloroanilino)-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-10-3-6-15(22-2)14(7-10)20-16(21)9-19-13-5-4-11(17)8-12(13)18/h3-8,19H,9H2,1-2H3,(H,20,21) |
| InChIKey | FCMYTEOWTGOGCH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |