C9H7Cl4NO — CID 521736
2,2-dichloro-N-(2,4-dichlorophenyl)propanamide (PubChem CID 521736) has the molecular formula C9H7Cl4NO and a molecular weight of 286.97 g/mol. Its IUPAC name is 2,2-dichloro-N-(2,4-dichlorophenyl)propanamide.
| Compound Name | 2,2-dichloro-N-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 521736 |
| Molecular Formula | C9H7Cl4NO |
| Molecular Weight | 286.97 g/mol |
| Exact Mass | 284.93 |
| IUPAC Name | 2,2-dichloro-N-(2,4-dichlorophenyl)propanamide |
| SMILES | CC(Cl)(Cl)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl4NO/c1-9(12,13)8(15)14-7-3-2-5(10)4-6(7)11/h2-4H,1H3,(H,14,15) |
| InChIKey | LYLOVGGYRYQRNQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.97 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|