C15H19Cl2N3O3 — CID 4927502
N-(2,4-dichlorophenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide (PubChem CID 4927502) has the molecular formula C15H19Cl2N3O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 4927502 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[2-(2,2-dimethylpropanoyl)hydrazinyl]-4-oxobutanamide |
| SMILES | CC(C)(C)C(=O)NNC(=O)CCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-15(2,3)14(23)20-19-13(22)7-6-12(21)18-11-5-4-9(16)8-10(11)17/h4-5,8H,6-7H2,1-3H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | ZANJUODTNZISLS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|