C18H15Cl3N4O3S — CID 3540219
2-chloro-N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide (PubChem CID 3540219) has the molecular formula C18H15Cl3N4O3S and a molecular weight of 473.77 g/mol. Its IUPAC name is 2-chloro-N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3540219 |
| Molecular Formula | C18H15Cl3N4O3S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 2-chloro-N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)cc1Cl)NNC(=S)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H15Cl3N4O3S/c19-10-5-6-14(13(21)9-10)22-15(26)7-8-16(27)24-25-18(29)23-17(28)11-3-1-2-4-12(11)20/h1-6,9H,7-8H2,(H,22,26)(H,24,27)(H2,23,25,28,29) |
| InChIKey | ANJVOLVJWQDYMX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|