C18H15Cl2N5O5S — CID 4659713
N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]-3-nitrobenzamide (PubChem CID 4659713) has the molecular formula C18H15Cl2N5O5S and a molecular weight of 484.32 g/mol. Its IUPAC name is N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]-3-nitrobenzamide.
| Compound Name | N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4659713 |
| Molecular Formula | C18H15Cl2N5O5S |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | N-[[[4-(2,4-dichloroanilino)-4-oxobutanoyl]amino]carbamothioyl]-3-nitrobenzamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)cc1Cl)NNC(=S)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15Cl2N5O5S/c19-11-4-5-14(13(20)9-11)21-15(26)6-7-16(27)23-24-18(31)22-17(28)10-2-1-3-12(8-10)25(29)30/h1-5,8-9H,6-7H2,(H,21,26)(H,23,27)(H2,22,24,28,31) |
| InChIKey | FNKWYFNBCPSMOH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|