C15H10Cl2N4O4S — CID 17133971
3,5-dichloro-N-[[(3-nitrobenzoyl)amino]carbamothioyl]benzamide (PubChem CID 17133971) has the molecular formula C15H10Cl2N4O4S and a molecular weight of 413.24 g/mol. Its IUPAC name is 3,5-dichloro-N-[[(3-nitrobenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[(3-nitrobenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17133971 |
| Molecular Formula | C15H10Cl2N4O4S |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 3,5-dichloro-N-[[(3-nitrobenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1cc(Cl)cc(Cl)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10Cl2N4O4S/c16-10-4-9(5-11(17)7-10)13(22)18-15(26)20-19-14(23)8-2-1-3-12(6-8)21(24)25/h1-7H,(H,19,23)(H2,18,20,22,26) |
| InChIKey | NAOIQJCFLUUTDP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|