C17H14Cl2N4O5S — CID 4500086
2-(2,4-dichlorophenoxy)-N-[[(3-nitrobenzoyl)amino]carbamothioyl]propanamide (PubChem CID 4500086) has the molecular formula C17H14Cl2N4O5S and a molecular weight of 457.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[[(3-nitrobenzoyl)amino]carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[[(3-nitrobenzoyl)amino]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 4500086 |
| Molecular Formula | C17H14Cl2N4O5S |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[[(3-nitrobenzoyl)amino]carbamothioyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14Cl2N4O5S/c1-9(28-14-6-5-11(18)8-13(14)19)15(24)20-17(29)22-21-16(25)10-3-2-4-12(7-10)23(26)27/h2-9H,1H3,(H,21,25)(H2,20,22,24,29) |
| InChIKey | ZAWQYYZGKUYAJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|