C19H16Cl2N4O5S — CID 17187369
(E)-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 17187369) has the molecular formula C19H16Cl2N4O5S and a molecular weight of 483.33 g/mol. Its IUPAC name is (E)-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17187369 |
| Molecular Formula | C19H16Cl2N4O5S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | (E)-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=S)NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16Cl2N4O5S/c1-11(30-16-8-5-13(20)10-15(16)21)18(27)23-24-19(31)22-17(26)9-4-12-2-6-14(7-3-12)25(28)29/h2-11H,1H3,(H,23,27)(H2,22,24,26,31)/b9-4+ |
| InChIKey | NJDZHYULZUDEPJ-RUDMXATFSA-N |
| XLogP | 3.40 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|