C18H15ClN4O4S — CID 17187410
(E)-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 17187410) has the molecular formula C18H15ClN4O4S and a molecular weight of 418.86 g/mol. Its IUPAC name is (E)-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17187410 |
| Molecular Formula | C18H15ClN4O4S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (E)-N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)NNC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN4O4S/c19-14-6-1-13(2-7-14)11-17(25)21-22-18(28)20-16(24)10-5-12-3-8-15(9-4-12)23(26)27/h1-10H,11H2,(H,21,25)(H2,20,22,24,28)/b10-5+ |
| InChIKey | XPRJPCDYWJFOOT-BJMVGYQFSA-N |
| XLogP | 2.53 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|