C16H13N5O4S — CID 17187349
(E)-3-(4-nitrophenyl)-N-[(pyridine-4-carbonylamino)carbamothioyl]prop-2-enamide (PubChem CID 17187349) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-[(pyridine-4-carbonylamino)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-[(pyridine-4-carbonylamino)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17187349 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-[(pyridine-4-carbonylamino)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C16H13N5O4S/c22-14(6-3-11-1-4-13(5-2-11)21(24)25)18-16(26)20-19-15(23)12-7-9-17-10-8-12/h1-10H,(H,19,23)(H2,18,20,22,26)/b6-3+ |
| InChIKey | FOKJLDPHFVXZFR-ZZXKWVIFSA-N |
| XLogP | 1.34 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|