C13H10N4O3S2 — CID 17187147
(E)-3-(4-nitrophenyl)-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide (PubChem CID 17187147) has the molecular formula C13H10N4O3S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 17187147 |
| Molecular Formula | C13H10N4O3S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)Nc1nccs1 |
| InChI | InChI=1S/C13H10N4O3S2/c18-11(15-12(21)16-13-14-7-8-22-13)6-3-9-1-4-10(5-2-9)17(19)20/h1-8H,(H2,14,15,16,18,21)/b6-3+ |
| InChIKey | DLGUGJXJNGQTER-ZZXKWVIFSA-N |
| XLogP | 2.58 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|