C13H11N3OS2 — CID 92527231
(Z)-3-phenyl-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide (PubChem CID 92527231) has the molecular formula C13H11N3OS2 and a molecular weight of 289.39 g/mol. Its IUPAC name is (Z)-3-phenyl-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide.
| Compound Name | (Z)-3-phenyl-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 92527231 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (Z)-3-phenyl-N-(1,3-thiazol-2-ylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)NC(=S)Nc1nccs1 |
| InChI | InChI=1S/C13H11N3OS2/c17-11(7-6-10-4-2-1-3-5-10)15-12(18)16-13-14-8-9-19-13/h1-9H,(H2,14,15,16,17,18)/b7-6- |
| InChIKey | JCQMBYYUJFKIRN-SREVYHEPSA-N |
| XLogP | 2.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|