C26H21N3O2S2 — CID 23096846
(E)-N-[4-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 23096846) has the molecular formula C26H21N3O2S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is (E)-N-[4-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 23096846 |
| Molecular Formula | C26H21N3O2S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (E)-N-[4-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc(SC(C(=O)Nc2nccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O2S2/c30-23(16-11-19-7-3-1-4-8-19)28-21-12-14-22(15-13-21)33-24(20-9-5-2-6-10-20)25(31)29-26-27-17-18-32-26/h1-18,24H,(H,28,30)(H,27,29,31)/b16-11+ |
| InChIKey | KBAQSIFJAQSNEN-LFIBNONCSA-N |
| XLogP | 6.27 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|