C31H25N3O2S2 — CID 21168696
(E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 21168696) has the molecular formula C31H25N3O2S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is (E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 21168696 |
| Molecular Formula | C31H25N3O2S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | (E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc2nc(NC(=O)C(Sc3ccc(NC(=O)/C=C/c4ccccc4)cc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C31H25N3O2S2/c1-21-12-18-26-27(20-21)38-31(33-26)34-30(36)29(23-10-6-3-7-11-23)37-25-16-14-24(15-17-25)32-28(35)19-13-22-8-4-2-5-9-22/h2-20,29H,1H3,(H,32,35)(H,33,34,36)/b19-13+ |
| InChIKey | SXBTTWGEEJKUBA-CPNJWEJPSA-N |
| XLogP | 7.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|