C25H21N3O2S2 — CID 23095376
(E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 23095376) has the molecular formula C25H21N3O2S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is (E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 23095376 |
| Molecular Formula | C25H21N3O2S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (E)-N-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc2nc(NC(=O)CSc3ccc(NC(=O)/C=C/c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C25H21N3O2S2/c1-17-7-13-21-22(15-17)32-25(27-21)28-24(30)16-31-20-11-9-19(10-12-20)26-23(29)14-8-18-5-3-2-4-6-18/h2-15H,16H2,1H3,(H,26,29)(H,27,28,30)/b14-8+ |
| InChIKey | UTKZZHVXIQQBOE-RIYZIHGNSA-N |
| XLogP | 5.99 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|