C32H26N4O3S2 — CID 19715187
N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19715187) has the molecular formula C32H26N4O3S2 and a molecular weight of 578.72 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19715187 |
| Molecular Formula | C32H26N4O3S2 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C32H26N4O3S2/c1-21-11-13-22(14-12-21)19-27(34-30(38)23-7-3-2-4-8-23)31(39)33-24-15-17-25(18-16-24)40-20-29(37)36-32-35-26-9-5-6-10-28(26)41-32/h2-19H,20H2,1H3,(H,33,39)(H,34,38)(H,35,36,37)/b27-19- |
| InChIKey | IGQRBYMJFYYKAA-DIBXZPPDSA-N |
| XLogP | 6.75 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|