C30H23N5O3S2 — CID 19714902
N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19714902) has the molecular formula C30H23N5O3S2 and a molecular weight of 565.68 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714902 |
| Molecular Formula | C30H23N5O3S2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C30H23N5O3S2/c36-27(35-30-34-24-10-4-5-11-26(24)40-30)19-39-23-14-12-22(13-15-23)32-29(38)25(17-20-7-6-16-31-18-20)33-28(37)21-8-2-1-3-9-21/h1-18H,19H2,(H,32,38)(H,33,37)(H,34,35,36)/b25-17- |
| InChIKey | JSRFRZGPZPKNTN-UQQQWYQISA-N |
| XLogP | 5.83 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|