C28H22ClN5O3S — CID 19714905
N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19714905) has the molecular formula C28H22ClN5O3S and a molecular weight of 544.04 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714905 |
| Molecular Formula | C28H22ClN5O3S |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C28H22ClN5O3S/c29-21-8-13-25(31-17-21)34-26(35)18-38-23-11-9-22(10-12-23)32-28(37)24(15-19-5-4-14-30-16-19)33-27(36)20-6-2-1-3-7-20/h1-17H,18H2,(H,32,37)(H,33,36)(H,31,34,35)/b24-15- |
| InChIKey | QSENRVWZZFNVOO-IWIPYMOSSA-N |
| XLogP | 5.27 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|