C31H27ClN4O5S — CID 22189027
N-[(Z)-3-[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22189027) has the molecular formula C31H27ClN4O5S and a molecular weight of 603.10 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189027 |
| Molecular Formula | C31H27ClN4O5S |
| Molecular Weight | 603.10 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N-[(Z)-3-[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(NC(=O)CSc2ccc(NC(=O)/C(=C/c3cccnc3)NC(=O)c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C31H27ClN4O5S/c1-40-27-17-28(41-2)25(16-24(27)32)35-29(37)19-42-23-12-10-22(11-13-23)34-31(39)26(15-20-7-6-14-33-18-20)36-30(38)21-8-4-3-5-9-21/h3-18H,19H2,1-2H3,(H,34,39)(H,35,37)(H,36,38)/b26-15- |
| InChIKey | PAFHCWUPHUONSE-YSMPRRRNSA-N |
| XLogP | 5.89 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.10 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|