C31H28N4O5S — CID 19714095
N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19714095) has the molecular formula C31H28N4O5S and a molecular weight of 568.66 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714095 |
| Molecular Formula | C31H28N4O5S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccncc3)cc2)cc1OC |
| InChI | InChI=1S/C31H28N4O5S/c1-39-27-13-8-21(19-28(27)40-2)18-26(35-30(37)22-6-4-3-5-7-22)31(38)34-23-9-11-25(12-10-23)41-20-29(36)33-24-14-16-32-17-15-24/h3-19H,20H2,1-2H3,(H,34,38)(H,35,37)(H,32,33,36)/b26-18- |
| InChIKey | CTQSLOURDOGAGF-ITYLOYPMSA-N |
| XLogP | 5.24 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|