C33H28F3N3O5S — CID 21386087
N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21386087) has the molecular formula C33H28F3N3O5S and a molecular weight of 635.66 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386087 |
| Molecular Formula | C33H28F3N3O5S |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.17 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccccc3C(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C33H28F3N3O5S/c1-43-28-17-12-21(19-29(28)44-2)18-27(39-31(41)22-8-4-3-5-9-22)32(42)37-23-13-15-24(16-14-23)45-20-30(40)38-26-11-7-6-10-25(26)33(34,35)36/h3-19H,20H2,1-2H3,(H,37,42)(H,38,40)(H,39,41)/b27-18- |
| InChIKey | JCOAGDFGQJPNMQ-IMRQLAEWSA-N |
| XLogP | 6.86 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|