C34H31N3O8S — CID 22190521
3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 22190521) has the molecular formula C34H31N3O8S and a molecular weight of 641.70 g/mol. Its IUPAC name is 3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22190521 |
| Molecular Formula | C34H31N3O8S |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3cccc(C(=O)O)c3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C34H31N3O8S/c1-43-28-17-21(18-29(44-2)31(28)45-3)16-27(37-32(39)22-8-5-4-6-9-22)33(40)36-24-12-14-26(15-13-24)46-20-30(38)35-25-11-7-10-23(19-25)34(41)42/h4-19H,20H2,1-3H3,(H,35,38)(H,36,40)(H,37,39)(H,41,42)/b27-16- |
| InChIKey | MEVSQMQKFCTDQP-YUMHPJSZSA-N |
| XLogP | 5.55 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|