C34H33N3O6S — CID 19314333
N-[(E)-3-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314333) has the molecular formula C34H33N3O6S and a molecular weight of 611.72 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314333 |
| Molecular Formula | C34H33N3O6S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | N-[(E)-3-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)Nc3ccc(C)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C34H33N3O6S/c1-22-13-15-25(16-14-22)35-31(38)21-44-27-12-8-11-26(20-27)36-34(40)28(37-33(39)24-9-6-5-7-10-24)17-23-18-29(41-2)32(43-4)30(19-23)42-3/h5-20H,21H2,1-4H3,(H,35,38)(H,36,40)(H,37,39)/b28-17+ |
| InChIKey | UNOAERCBJGQOSS-OGLMXYFKSA-N |
| XLogP | 6.16 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|