C32H29N3O4S — CID 19313485
N-[(E)-3-[3-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19313485) has the molecular formula C32H29N3O4S and a molecular weight of 551.67 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313485 |
| Molecular Formula | C32H29N3O4S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | N-[(E)-3-[3-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cccc(C)c3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H29N3O4S/c1-22-8-6-9-23(18-22)19-29(35-31(37)24-10-4-3-5-11-24)32(38)34-26-12-7-13-28(20-26)40-21-30(36)33-25-14-16-27(39-2)17-15-25/h3-20H,21H2,1-2H3,(H,33,36)(H,34,38)(H,35,37)/b29-19+ |
| InChIKey | ZESYEZYAOANPSN-VUTHCHCSSA-N |
| XLogP | 6.14 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|