C33H31N3O5S — CID 19313481
N-[(E)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19313481) has the molecular formula C33H31N3O5S and a molecular weight of 581.69 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313481 |
| Molecular Formula | C33H31N3O5S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | N-[(E)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cccc(C)c3)NC(=O)c3ccccc3)c2)cc(OC)c1 |
| InChI | InChI=1S/C33H31N3O5S/c1-22-9-7-10-23(15-22)16-30(36-32(38)24-11-5-4-6-12-24)33(39)35-25-13-8-14-29(19-25)42-21-31(37)34-26-17-27(40-2)20-28(18-26)41-3/h4-20H,21H2,1-3H3,(H,34,37)(H,35,39)(H,36,38)/b30-16+ |
| InChIKey | ASSYUFKKWUKECG-OKCVXOCRSA-N |
| XLogP | 6.15 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|