C35H35N3O8S — CID 22190502
N-[(Z)-3-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190502) has the molecular formula C35H35N3O8S and a molecular weight of 657.75 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190502 |
| Molecular Formula | C35H35N3O8S |
| Molecular Weight | 657.75 g/mol |
| Exact Mass | 657.21 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(NC(=O)CSc2ccc(NC(=O)/C(=C/c3cc(OC)c(OC)c(OC)c3)NC(=O)c3ccccc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C35H35N3O8S/c1-42-26-18-25(19-27(20-26)43-2)36-32(39)21-47-28-13-11-24(12-14-28)37-35(41)29(38-34(40)23-9-7-6-8-10-23)15-22-16-30(44-3)33(46-5)31(17-22)45-4/h6-20H,21H2,1-5H3,(H,36,39)(H,37,41)(H,38,40)/b29-15- |
| InChIKey | WVXGDHJFJFVDIS-FDVSRXAVSA-N |
| XLogP | 5.87 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|