C32H29N3O5S — CID 21385666
N-[(Z)-3-[4-(2-anilino-2-oxoethyl)sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385666) has the molecular formula C32H29N3O5S and a molecular weight of 567.67 g/mol. Its IUPAC name is N-[(Z)-3-[4-(2-anilino-2-oxoethyl)sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(2-anilino-2-oxoethyl)sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385666 |
| Molecular Formula | C32H29N3O5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | N-[(Z)-3-[4-(2-anilino-2-oxoethyl)sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H29N3O5S/c1-39-26-16-13-23(29(20-26)40-2)19-28(35-31(37)22-9-5-3-6-10-22)32(38)34-25-14-17-27(18-15-25)41-21-30(36)33-24-11-7-4-8-12-24/h3-20H,21H2,1-2H3,(H,33,36)(H,34,38)(H,35,37)/b28-19- |
| InChIKey | BAVAZVGQQCSPBC-USHMODERSA-N |
| XLogP | 5.84 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|