C32H28ClN3O5S — CID 21385674
N-[(Z)-3-[4-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385674) has the molecular formula C32H28ClN3O5S and a molecular weight of 602.11 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385674 |
| Molecular Formula | C32H28ClN3O5S |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccc(Cl)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H28ClN3O5S/c1-40-26-15-8-22(29(19-26)41-2)18-28(36-31(38)21-6-4-3-5-7-21)32(39)35-25-13-16-27(17-14-25)42-20-30(37)34-24-11-9-23(33)10-12-24/h3-19H,20H2,1-2H3,(H,34,37)(H,35,39)(H,36,38)/b28-18- |
| InChIKey | FPOMOTXHBAUHSS-VEILYXNESA-N |
| XLogP | 6.50 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|