C33H29N3O8S — CID 21385733
5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 21385733) has the molecular formula C33H29N3O8S and a molecular weight of 627.68 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 21385733 |
| Molecular Formula | C33H29N3O8S |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccc(O)c(C(=O)O)c3)cc2)c(OC)c1 |
| InChI | InChI=1S/C33H29N3O8S/c1-43-24-12-8-21(29(18-24)44-2)16-27(36-31(39)20-6-4-3-5-7-20)32(40)35-22-9-13-25(14-10-22)45-19-30(38)34-23-11-15-28(37)26(17-23)33(41)42/h3-18,37H,19H2,1-2H3,(H,34,38)(H,35,40)(H,36,39)(H,41,42)/b27-16- |
| InChIKey | DTWCUKQBDQDZFE-YUMHPJSZSA-N |
| XLogP | 5.25 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|