C32H27N3O6S — CID 22186740
4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 22186740) has the molecular formula C32H27N3O6S and a molecular weight of 581.65 g/mol. Its IUPAC name is 4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22186740 |
| Molecular Formula | C32H27N3O6S |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | COc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SCC(=O)Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H27N3O6S/c1-41-28-10-6-5-9-23(28)19-27(35-30(37)21-7-3-2-4-8-21)31(38)34-25-15-17-26(18-16-25)42-20-29(36)33-24-13-11-22(12-14-24)32(39)40/h2-19H,20H2,1H3,(H,33,36)(H,34,38)(H,35,37)(H,39,40)/b27-19- |
| InChIKey | LRAWVOFPYDZVTL-DIBXZPPDSA-N |
| XLogP | 5.53 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|