C35H33N3O7S — CID 22190286
N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190286) has the molecular formula C35H33N3O7S and a molecular weight of 639.73 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190286 |
| Molecular Formula | C35H33N3O7S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SCC(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C35H33N3O7S/c1-22(39)23-10-12-26(13-11-23)36-33(40)21-46-28-16-14-27(15-17-28)37-35(42)29(38-34(41)24-8-6-5-7-9-24)18-25-19-31(44-3)32(45-4)20-30(25)43-2/h5-20H,21H2,1-4H3,(H,36,40)(H,37,42)(H,38,41)/b29-18- |
| InChIKey | JZOGFKPZAXFIHT-MIXAMLLLSA-N |
| XLogP | 6.06 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|