C32H27N3O4S — CID 21383598
N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 21383598) has the molecular formula C32H27N3O4S and a molecular weight of 549.65 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21383598 |
| Molecular Formula | C32H27N3O4S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)/C(=C/c3ccccc3)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H27N3O4S/c1-22(36)24-12-14-26(15-13-24)33-30(37)21-40-28-18-16-27(17-19-28)34-32(39)29(20-23-8-4-2-5-9-23)35-31(38)25-10-6-3-7-11-25/h2-20H,21H2,1H3,(H,33,37)(H,34,39)(H,35,38)/b29-20- |
| InChIKey | VLSZKINUWFARMW-BRPDVVIDSA-N |
| XLogP | 6.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|