C34H27N3O3S — CID 21383600
N-[(Z)-3-[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 21383600) has the molecular formula C34H27N3O3S and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21383600 |
| Molecular Formula | C34H27N3O3S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | N-[(Z)-3-[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)cc1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H27N3O3S/c38-32(35-29-16-15-25-11-7-8-14-27(25)22-29)23-41-30-19-17-28(18-20-30)36-34(40)31(21-24-9-3-1-4-10-24)37-33(39)26-12-5-2-6-13-26/h1-22H,23H2,(H,35,38)(H,36,40)(H,37,39)/b31-21- |
| InChIKey | OIQFQBUEHZWZLV-YQYKVWLJSA-N |
| XLogP | 6.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|