C30H23Cl2N3O3S — CID 19304819
N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19304819) has the molecular formula C30H23Cl2N3O3S and a molecular weight of 576.51 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304819 |
| Molecular Formula | C30H23Cl2N3O3S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H23Cl2N3O3S/c31-25-15-14-23(18-26(25)32)33-28(36)19-39-24-13-7-12-22(17-24)34-30(38)27(16-20-8-3-1-4-9-20)35-29(37)21-10-5-2-6-11-21/h1-18H,19H2,(H,33,36)(H,34,38)(H,35,37)/b27-16- |
| InChIKey | KOMRDJUUTZKGSH-YUMHPJSZSA-N |
| XLogP | 7.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|