C30H22BrCl2N3O3S — CID 22191110
N-[(Z)-1-(4-bromophenyl)-3-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191110) has the molecular formula C30H22BrCl2N3O3S and a molecular weight of 655.40 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)-3-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)-3-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191110 |
| Molecular Formula | C30H22BrCl2N3O3S |
| Molecular Weight | 655.40 g/mol |
| Exact Mass | 652.99 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)-3-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccc(Br)cc2)NC(=O)c2ccccc2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H22BrCl2N3O3S/c31-21-8-6-19(7-9-21)16-27(36-29(38)20-4-2-1-3-5-20)30(39)35-22-10-13-24(14-11-22)40-18-28(37)34-23-12-15-25(32)26(33)17-23/h1-17H,18H2,(H,34,37)(H,35,39)(H,36,38)/b27-16- |
| InChIKey | FNDVINSFQYJUJL-YUMHPJSZSA-N |
| XLogP | 7.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.40 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|