C29H23ClN4O3S — CID 19312299
N-[(Z)-3-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312299) has the molecular formula C29H23ClN4O3S and a molecular weight of 543.05 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312299 |
| Molecular Formula | C29H23ClN4O3S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | N-[(Z)-3-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H23ClN4O3S/c30-22-11-13-23(14-12-22)32-27(35)19-38-25-10-4-9-24(17-25)33-29(37)26(16-20-6-5-15-31-18-20)34-28(36)21-7-2-1-3-8-21/h1-18H,19H2,(H,32,35)(H,33,37)(H,34,36)/b26-16- |
| InChIKey | YAWBRBTYIPIKRE-QQXSKIMKSA-N |
| XLogP | 5.88 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|