C37H26N4O5S — CID 19320777
N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19320777) has the molecular formula C37H26N4O5S and a molecular weight of 638.71 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320777 |
| Molecular Formula | C37H26N4O5S |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | N-[(E)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2cccnc2)NC(=O)c2ccccc2)c1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C37H26N4O5S/c42-32(40-30-17-7-16-29-33(30)35(44)28-15-5-4-14-27(28)34(29)43)22-47-26-13-6-12-25(20-26)39-37(46)31(19-23-9-8-18-38-21-23)41-36(45)24-10-2-1-3-11-24/h1-21H,22H2,(H,39,46)(H,40,42)(H,41,45)/b31-19+ |
| InChIKey | RNBHJTMPLVPNRD-ZCTHSVRISA-N |
| XLogP | 6.00 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|