C31H28N4O3S — CID 22189013
N-[(Z)-3-[4-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22189013) has the molecular formula C31H28N4O3S and a molecular weight of 536.66 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189013 |
| Molecular Formula | C31H28N4O3S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2,4-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccc(NC(=O)/C(=C/c3cccnc3)NC(=O)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H28N4O3S/c1-21-10-15-27(22(2)17-21)34-29(36)20-39-26-13-11-25(12-14-26)33-31(38)28(18-23-7-6-16-32-19-23)35-30(37)24-8-4-3-5-9-24/h3-19H,20H2,1-2H3,(H,33,38)(H,34,36)(H,35,37)/b28-18- |
| InChIKey | BJIVAQWBMCPGJE-VEILYXNESA-N |
| XLogP | 5.84 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|